د یورولوتین B پاؤډر

د نومبر 9، 2020

Urolithin BSتقویت

نوم: یوروتین بی
کیمیاوي نوم: 3-هایډروکسي -6 ايچ - ډایبینزو [b، d] پیران -6-یو
CAS: 1139-83-9
د کیمیاوي فورمول: ککسومکسکسکسکسکسکسکس
مالیکول وزن: 212.2 g / mol
رنګ:  سپينه پوډر
د InChi کیلي: WXUQMTRHPNOXBV-UHFFFAOYSA-N
د مسکو کوډ: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
دنده: Urolithin B کولی شي د مایټوکونډرال او عضلاتو فعالیت ته وده ورکړي.

Urolithin B کولی شي د عمر په جریان کې د عضلاتو ځواک او برداشت ته وده ورکړي.

تطبیق: ارووليتین بی د ایلګیتانینس انتاني میکروبیل میتابولیت دی او د قوي سیسټم او شرایطو پورې اړوند د قوي انټي آکسیډینټ او پرو آکسیډینټ فعالیتونه وړاندې کوي. Urolithin B کولی شي د ایسټروجینک او / یا د ایسټروجن ضد فعالیت هم وښیې.
سوځښت: په N ، N-dimethylformamide او dimethylmethylene کې په اسانۍ محلول کیږي. سلفون ، په میتانول ، ایتانول ، او ایتیل اسیتیټ کې یو څه محلول کیږي
د ذخیره کولو ټیم: Hygroscopic، -20 ° C فریزر، کم ژور چاپیریال
د بار وړلو شرایط: د محیطي حرارت درجه د غیر خطرناکه کیمیاوي په توګه لیږدول شوې. دا محصول د څو اونیو لپاره د عادي لېږد او وخت په ګمرک کې مصرف شوي وخت لپاره کافی ثبات لري.

 

یوروتین بی د NMR سپیکٹرم

یورولوتین بی (1139-83-9) - د NMR سپیکٹرم

 

که تاسو د محصول هرې ډلې او نورو معلوماتو لپاره COA ، MSDS ، HNMR ته اړتیا لرئ ، مهرباني وکړئ زموږ سره اړیکه ونیسئ د بازار موندنې مدیر.